C30H44N6O3 — CID 177317568
5-[[5-(aminomethyl)-2-methoxyphenyl]methyl]-4-N-butylpyrimido[5,4-b]indole-2,4-diamine;cyclopentanol;ethanol (PubChem CID 177317568) has the molecular formula C30H44N6O3 and a molecular weight of 536.72 g/mol. Its IUPAC name is 5-[[5-(aminomethyl)-2-methoxyphenyl]methyl]-4-N-butylpyrimido[5,4-b]indole-2,4-diamine;cyclopentanol;ethanol.
| Compound Name | 5-[[5-(aminomethyl)-2-methoxyphenyl]methyl]-4-N-butylpyrimido[5,4-b]indole-2,4-diamine;cyclopentanol;ethanol |
|---|---|
| PubChem CID | 177317568 |
| Molecular Formula | C30H44N6O3 |
| Molecular Weight | 536.72 g/mol |
| Exact Mass | 536.35 |
| IUPAC Name | 5-[[5-(aminomethyl)-2-methoxyphenyl]methyl]-4-N-butylpyrimido[5,4-b]indole-2,4-diamine;cyclopentanol;ethanol |
| SMILES | CCCCNc1nc(N)nc2c3ccccc3n(Cc3cc(CN)ccc3OC)c12.CCO.OC1CCCC1 |
| InChI | InChI=1S/C23H28N6O.C5H10O.C2H6O/c1-3-4-11-26-22-21-20(27-23(25)28-22)17-7-5-6-8-18(17)29(21)14-16-12-15(13-24)9-10-19(16)30-2;6-5-3-1-2-4-5;1-2-3/h5-10,12H,3-4,11,13-14,24H2,1-2H3,(H3,25,26,27,28);5-6H,1-4H2;3H,2H2,1H3 |
| InChIKey | JMVMSMYBFHHXSQ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 144.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.72 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|