C28H40N6O2S — CID 177317594
4-N-butyl-5-[[2-methoxy-5-[(2-methylsulfanylethylamino)methyl]phenyl]methyl]pyrimido[5,4-b]indole-2,4-diamine;ethanol (PubChem CID 177317594) has the molecular formula C28H40N6O2S and a molecular weight of 524.74 g/mol. Its IUPAC name is 4-N-butyl-5-[[2-methoxy-5-[(2-methylsulfanylethylamino)methyl]phenyl]methyl]pyrimido[5,4-b]indole-2,4-diamine;ethanol.
| Compound Name | 4-N-butyl-5-[[2-methoxy-5-[(2-methylsulfanylethylamino)methyl]phenyl]methyl]pyrimido[5,4-b]indole-2,4-diamine;ethanol |
|---|---|
| PubChem CID | 177317594 |
| Molecular Formula | C28H40N6O2S |
| Molecular Weight | 524.74 g/mol |
| Exact Mass | 524.29 |
| IUPAC Name | 4-N-butyl-5-[[2-methoxy-5-[(2-methylsulfanylethylamino)methyl]phenyl]methyl]pyrimido[5,4-b]indole-2,4-diamine;ethanol |
| SMILES | CCCCNc1nc(N)nc2c3ccccc3n(Cc3cc(CNCCSC)ccc3OC)c12.CCO |
| InChI | InChI=1S/C26H34N6OS.C2H6O/c1-4-5-12-29-25-24-23(30-26(27)31-25)20-8-6-7-9-21(20)32(24)17-19-15-18(10-11-22(19)33-2)16-28-13-14-34-3;1-2-3/h6-11,15,28H,4-5,12-14,16-17H2,1-3H3,(H3,27,29,30,31);3H,2H2,1H3 |
| InChIKey | BARXUBZUAFYPCH-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 110.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.74 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|