C27H32N6O — CID 177317420
4-N-butyl-5-[[2-methoxy-5-(1,2,3,6-tetrahydropyridin-5-yl)phenyl]methyl]pyrimido[5,4-b]indole-2,4-diamine (PubChem CID 177317420) has the molecular formula C27H32N6O and a molecular weight of 456.59 g/mol. Its IUPAC name is 4-N-butyl-5-[[2-methoxy-5-(1,2,3,6-tetrahydropyridin-5-yl)phenyl]methyl]pyrimido[5,4-b]indole-2,4-diamine.
| Compound Name | 4-N-butyl-5-[[2-methoxy-5-(1,2,3,6-tetrahydropyridin-5-yl)phenyl]methyl]pyrimido[5,4-b]indole-2,4-diamine |
|---|---|
| PubChem CID | 177317420 |
| Molecular Formula | C27H32N6O |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | 4-N-butyl-5-[[2-methoxy-5-(1,2,3,6-tetrahydropyridin-5-yl)phenyl]methyl]pyrimido[5,4-b]indole-2,4-diamine |
| SMILES | CCCCNc1nc(N)nc2c3ccccc3n(Cc3cc(C4=CCCNC4)ccc3OC)c12 |
| InChI | InChI=1S/C27H32N6O/c1-3-4-14-30-26-25-24(31-27(28)32-26)21-9-5-6-10-22(21)33(25)17-20-15-18(11-12-23(20)34-2)19-8-7-13-29-16-19/h5-6,8-12,15,29H,3-4,7,13-14,16-17H2,1-2H3,(H3,28,30,31,32) |
| InChIKey | ZKBIYFQUFWRTIA-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|