C30H31N7O — CID 177317535
2-[[3-[[2-amino-4-(butylamino)pyrimido[5,4-b]indol-5-yl]methyl]-4-methoxyphenyl]methylamino]benzonitrile (PubChem CID 177317535) has the molecular formula C30H31N7O and a molecular weight of 505.63 g/mol. Its IUPAC name is 2-[[3-[[2-amino-4-(butylamino)pyrimido[5,4-b]indol-5-yl]methyl]-4-methoxyphenyl]methylamino]benzonitrile.
| Compound Name | 2-[[3-[[2-amino-4-(butylamino)pyrimido[5,4-b]indol-5-yl]methyl]-4-methoxyphenyl]methylamino]benzonitrile |
|---|---|
| PubChem CID | 177317535 |
| Molecular Formula | C30H31N7O |
| Molecular Weight | 505.63 g/mol |
| Exact Mass | 505.26 |
| IUPAC Name | 2-[[3-[[2-amino-4-(butylamino)pyrimido[5,4-b]indol-5-yl]methyl]-4-methoxyphenyl]methylamino]benzonitrile |
| SMILES | CCCCNc1nc(N)nc2c3ccccc3n(Cc3cc(CNc4ccccc4C#N)ccc3OC)c12 |
| InChI | InChI=1S/C30H31N7O/c1-3-4-15-33-29-28-27(35-30(32)36-29)23-10-6-8-12-25(23)37(28)19-22-16-20(13-14-26(22)38-2)18-34-24-11-7-5-9-21(24)17-31/h5-14,16,34H,3-4,15,18-19H2,1-2H3,(H3,32,33,35,36) |
| InChIKey | JKXDVKGNMUJLRC-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.63 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|