C29H38N6O2 — CID 177317565
5-[[5-(3-aminocyclohexen-1-yl)-2-methoxyphenyl]methyl]-4-N-butylpyrimido[5,4-b]indole-2,4-diamine;methanol (PubChem CID 177317565) has the molecular formula C29H38N6O2 and a molecular weight of 502.66 g/mol. Its IUPAC name is 5-[[5-(3-aminocyclohexen-1-yl)-2-methoxyphenyl]methyl]-4-N-butylpyrimido[5,4-b]indole-2,4-diamine;methanol.
| Compound Name | 5-[[5-(3-aminocyclohexen-1-yl)-2-methoxyphenyl]methyl]-4-N-butylpyrimido[5,4-b]indole-2,4-diamine;methanol |
|---|---|
| PubChem CID | 177317565 |
| Molecular Formula | C29H38N6O2 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.31 |
| IUPAC Name | 5-[[5-(3-aminocyclohexen-1-yl)-2-methoxyphenyl]methyl]-4-N-butylpyrimido[5,4-b]indole-2,4-diamine;methanol |
| SMILES | CCCCNc1nc(N)nc2c3ccccc3n(Cc3cc(C4=CC(N)CCC4)ccc3OC)c12.CO |
| InChI | InChI=1S/C28H34N6O.CH4O/c1-3-4-14-31-27-26-25(32-28(30)33-27)22-10-5-6-11-23(22)34(26)17-20-15-19(12-13-24(20)35-2)18-8-7-9-21(29)16-18;1-2/h5-6,10-13,15-16,21H,3-4,7-9,14,17,29H2,1-2H3,(H3,30,31,32,33);2H,1H3 |
| InChIKey | FVBNNSUCYOPJOI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 124.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|