C33H47FN6O — CID 177317662
4-N-butyl-5-[[5-[[(3,3-dimethylcyclohexyl)amino]methyl]-2-methoxyphenyl]methyl]-8-fluoropyrimido[5,4-b]indole-2,4-diamine;ethane (PubChem CID 177317662) has the molecular formula C33H47FN6O and a molecular weight of 562.78 g/mol. Its IUPAC name is 4-N-butyl-5-[[5-[[(3,3-dimethylcyclohexyl)amino]methyl]-2-methoxyphenyl]methyl]-8-fluoropyrimido[5,4-b]indole-2,4-diamine;ethane.
| Compound Name | 4-N-butyl-5-[[5-[[(3,3-dimethylcyclohexyl)amino]methyl]-2-methoxyphenyl]methyl]-8-fluoropyrimido[5,4-b]indole-2,4-diamine;ethane |
|---|---|
| PubChem CID | 177317662 |
| Molecular Formula | C33H47FN6O |
| Molecular Weight | 562.78 g/mol |
| Exact Mass | 562.38 |
| IUPAC Name | 4-N-butyl-5-[[5-[[(3,3-dimethylcyclohexyl)amino]methyl]-2-methoxyphenyl]methyl]-8-fluoropyrimido[5,4-b]indole-2,4-diamine;ethane |
| SMILES | CC.CCCCNc1nc(N)nc2c3cc(F)ccc3n(Cc3cc(CNC4CCCC(C)(C)C4)ccc3OC)c12 |
| InChI | InChI=1S/C31H41FN6O.C2H6/c1-5-6-14-34-29-28-27(36-30(33)37-29)24-16-22(32)10-11-25(24)38(28)19-21-15-20(9-12-26(21)39-4)18-35-23-8-7-13-31(2,3)17-23;1-2/h9-12,15-16,23,35H,5-8,13-14,17-19H2,1-4H3,(H3,33,34,36,37);1-2H3 |
| InChIKey | FCKBFSOIBMZKGZ-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.78 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|