C31H37FN6O3 — CID 177317320
4-[[2-amino-8-fluoro-5-[[2-methoxy-5-[(oxan-4-ylamino)methyl]phenyl]methyl]pyrimido[5,4-b]indol-4-yl]amino]hept-2-yn-1-ol (PubChem CID 177317320) has the molecular formula C31H37FN6O3 and a molecular weight of 560.67 g/mol. Its IUPAC name is 4-[[2-amino-8-fluoro-5-[[2-methoxy-5-[(oxan-4-ylamino)methyl]phenyl]methyl]pyrimido[5,4-b]indol-4-yl]amino]hept-2-yn-1-ol.
| Compound Name | 4-[[2-amino-8-fluoro-5-[[2-methoxy-5-[(oxan-4-ylamino)methyl]phenyl]methyl]pyrimido[5,4-b]indol-4-yl]amino]hept-2-yn-1-ol |
|---|---|
| PubChem CID | 177317320 |
| Molecular Formula | C31H37FN6O3 |
| Molecular Weight | 560.67 g/mol |
| Exact Mass | 560.29 |
| IUPAC Name | 4-[[2-amino-8-fluoro-5-[[2-methoxy-5-[(oxan-4-ylamino)methyl]phenyl]methyl]pyrimido[5,4-b]indol-4-yl]amino]hept-2-yn-1-ol |
| SMILES | CCCC(C#CCO)Nc1nc(N)nc2c3cc(F)ccc3n(Cc3cc(CNC4CCOCC4)ccc3OC)c12 |
| InChI | InChI=1S/C31H37FN6O3/c1-3-5-24(6-4-13-39)35-30-29-28(36-31(33)37-30)25-17-22(32)8-9-26(25)38(29)19-21-16-20(7-10-27(21)40-2)18-34-23-11-14-41-15-12-23/h7-10,16-17,23-24,34,39H,3,5,11-15,18-19H2,1-2H3,(H3,33,35,36,37) |
| InChIKey | LJIWPUHPJVXNAN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 119.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.67 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|