C25H33N5O3 — CID 177317589
[3-[(2,4-diaminopyrimido[5,4-b]indol-5-yl)methyl]-4-methoxyphenyl]methanol;hexan-1-ol (PubChem CID 177317589) has the molecular formula C25H33N5O3 and a molecular weight of 451.57 g/mol. Its IUPAC name is [3-[(2,4-diaminopyrimido[5,4-b]indol-5-yl)methyl]-4-methoxyphenyl]methanol;hexan-1-ol.
| Compound Name | [3-[(2,4-diaminopyrimido[5,4-b]indol-5-yl)methyl]-4-methoxyphenyl]methanol;hexan-1-ol |
|---|---|
| PubChem CID | 177317589 |
| Molecular Formula | C25H33N5O3 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | [3-[(2,4-diaminopyrimido[5,4-b]indol-5-yl)methyl]-4-methoxyphenyl]methanol;hexan-1-ol |
| SMILES | CCCCCCO.COc1ccc(CO)cc1Cn1c2ccccc2c2nc(N)nc(N)c21 |
| InChI | InChI=1S/C19H19N5O2.C6H14O/c1-26-15-7-6-11(10-25)8-12(15)9-24-14-5-3-2-4-13(14)16-17(24)18(20)23-19(21)22-16;1-2-3-4-5-6-7/h2-8,25H,9-10H2,1H3,(H4,20,21,22,23);7H,2-6H2,1H3 |
| InChIKey | XCKXTHJFQNMLSQ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 132.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|