C21H25IN6O5 — CID 156813258
methyl 4-[[7-(butylamino)-3-iodo-5-(methoxycarbonylamino)pyrazolo[4,5-d]pyrimidin-1-yl]methyl]-3-methoxybenzoate (PubChem CID 156813258) has the molecular formula C21H25IN6O5 and a molecular weight of 568.37 g/mol. Its IUPAC name is methyl 4-[[7-(butylamino)-3-iodo-5-(methoxycarbonylamino)pyrazolo[4,5-d]pyrimidin-1-yl]methyl]-3-methoxybenzoate.
| Compound Name | methyl 4-[[7-(butylamino)-3-iodo-5-(methoxycarbonylamino)pyrazolo[4,5-d]pyrimidin-1-yl]methyl]-3-methoxybenzoate |
|---|---|
| PubChem CID | 156813258 |
| Molecular Formula | C21H25IN6O5 |
| Molecular Weight | 568.37 g/mol |
| Exact Mass | 568.09 |
| IUPAC Name | methyl 4-[[7-(butylamino)-3-iodo-5-(methoxycarbonylamino)pyrazolo[4,5-d]pyrimidin-1-yl]methyl]-3-methoxybenzoate |
| SMILES | CCCCNc1nc(NC(=O)OC)nc2c(I)nn(Cc3ccc(C(=O)OC)cc3OC)c12 |
| InChI | InChI=1S/C21H25IN6O5/c1-5-6-9-23-18-16-15(24-20(25-18)26-21(30)33-4)17(22)27-28(16)11-13-8-7-12(19(29)32-3)10-14(13)31-2/h7-8,10H,5-6,9,11H2,1-4H3,(H2,23,24,25,26,30) |
| InChIKey | IVSDZRHRTLIDFF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 129.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|