C23H31ClN8O2 — CID 165370799
1-[4-[6-[[5-amino-7-(butylamino)pyrazolo[4,5-d]pyrimidin-1-yl]methyl]-5-methoxy-3-pyridinyl]piperidin-1-yl]-2-chloroethanone (PubChem CID 165370799) has the molecular formula C23H31ClN8O2 and a molecular weight of 487.01 g/mol. Its IUPAC name is 1-[4-[6-[[5-amino-7-(butylamino)pyrazolo[4,5-d]pyrimidin-1-yl]methyl]-5-methoxy-3-pyridinyl]piperidin-1-yl]-2-chloroethanone.
| Compound Name | 1-[4-[6-[[5-amino-7-(butylamino)pyrazolo[4,5-d]pyrimidin-1-yl]methyl]-5-methoxy-3-pyridinyl]piperidin-1-yl]-2-chloroethanone |
|---|---|
| PubChem CID | 165370799 |
| Molecular Formula | C23H31ClN8O2 |
| Molecular Weight | 487.01 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | 1-[4-[6-[[5-amino-7-(butylamino)pyrazolo[4,5-d]pyrimidin-1-yl]methyl]-5-methoxy-3-pyridinyl]piperidin-1-yl]-2-chloroethanone |
| SMILES | CCCCNc1nc(N)nc2cnn(Cc3ncc(C4CCN(C(=O)CCl)CC4)cc3OC)c12 |
| InChI | InChI=1S/C23H31ClN8O2/c1-3-4-7-26-22-21-17(29-23(25)30-22)13-28-32(21)14-18-19(34-2)10-16(12-27-18)15-5-8-31(9-6-15)20(33)11-24/h10,12-13,15H,3-9,11,14H2,1-2H3,(H3,25,26,29,30) |
| InChIKey | KNEFAAQDNQFSDH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 124.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.01 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|