C27H41N5O — CID 171654200
N'-[(1E)-1-[1-[[2-methoxy-4-(piperazin-1-ylmethyl)phenyl]methyl]-3-methylidenepyrrol-2-ylidene]heptyl]ethanimidamide (PubChem CID 171654200) has the molecular formula C27H41N5O and a molecular weight of 451.66 g/mol. Its IUPAC name is N'-[(1E)-1-[1-[[2-methoxy-4-(piperazin-1-ylmethyl)phenyl]methyl]-3-methylidenepyrrol-2-ylidene]heptyl]ethanimidamide.
| Compound Name | N'-[(1E)-1-[1-[[2-methoxy-4-(piperazin-1-ylmethyl)phenyl]methyl]-3-methylidenepyrrol-2-ylidene]heptyl]ethanimidamide |
|---|---|
| PubChem CID | 171654200 |
| Molecular Formula | C27H41N5O |
| Molecular Weight | 451.66 g/mol |
| Exact Mass | 451.33 |
| IUPAC Name | N'-[(1E)-1-[1-[[2-methoxy-4-(piperazin-1-ylmethyl)phenyl]methyl]-3-methylidenepyrrol-2-ylidene]heptyl]ethanimidamide |
| SMILES | C=c1ccn(Cc2ccc(CN3CCNCC3)cc2OC)/c1=C(CCCCCC)/N=C(\C)N |
| InChI | InChI=1S/C27H41N5O/c1-5-6-7-8-9-25(30-22(3)28)27-21(2)12-15-32(27)20-24-11-10-23(18-26(24)33-4)19-31-16-13-29-14-17-31/h10-12,15,18,29H,2,5-9,13-14,16-17,19-20H2,1,3-4H3,(H2,28,30)/b27-25+ |
| InChIKey | LVFPIYQSEFHIAK-IMVLJIQESA-N |
| XLogP | 2.82 |
| TPSA | 67.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.66 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|