C27H41N5O2 — CID 171654270
N'-[(Z)-[1-[[2-methoxy-4-(piperazin-1-ylmethyl)phenyl]methyl]-3-methylidenepyrrol-2-ylidene]-pentoxymethyl]propanimidamide (PubChem CID 171654270) has the molecular formula C27H41N5O2 and a molecular weight of 467.66 g/mol. Its IUPAC name is N'-[(Z)-[1-[[2-methoxy-4-(piperazin-1-ylmethyl)phenyl]methyl]-3-methylidenepyrrol-2-ylidene]-pentoxymethyl]propanimidamide.
| Compound Name | N'-[(Z)-[1-[[2-methoxy-4-(piperazin-1-ylmethyl)phenyl]methyl]-3-methylidenepyrrol-2-ylidene]-pentoxymethyl]propanimidamide |
|---|---|
| PubChem CID | 171654270 |
| Molecular Formula | C27H41N5O2 |
| Molecular Weight | 467.66 g/mol |
| Exact Mass | 467.33 |
| IUPAC Name | N'-[(Z)-[1-[[2-methoxy-4-(piperazin-1-ylmethyl)phenyl]methyl]-3-methylidenepyrrol-2-ylidene]-pentoxymethyl]propanimidamide |
| SMILES | C=c1ccn(Cc2ccc(CN3CCNCC3)cc2OC)/c1=C(/N=C(/N)CC)OCCCCC |
| InChI | InChI=1S/C27H41N5O2/c1-5-7-8-17-34-27(30-25(28)6-2)26-21(3)11-14-32(26)20-23-10-9-22(18-24(23)33-4)19-31-15-12-29-13-16-31/h9-11,14,18,29H,3,5-8,12-13,15-17,19-20H2,1-2,4H3,(H2,28,30)/b27-26- |
| InChIKey | BSLFLJPZWADBAJ-RQZHXJHFSA-N |
| XLogP | 2.40 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.66 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|