C26H40N6O3 — CID 171654132
2-amino-N-[[4-[[(2E)-2-[[(E)-1-aminopropylideneamino]-(pentylamino)methylidene]-3-methylidenepyrrol-1-yl]methyl]-3-methoxyphenyl]methoxymethyl]acetamide (PubChem CID 171654132) has the molecular formula C26H40N6O3 and a molecular weight of 484.65 g/mol. Its IUPAC name is 2-amino-N-[[4-[[(2E)-2-[[(E)-1-aminopropylideneamino]-(pentylamino)methylidene]-3-methylidenepyrrol-1-yl]methyl]-3-methoxyphenyl]methoxymethyl]acetamide.
| Compound Name | 2-amino-N-[[4-[[(2E)-2-[[(E)-1-aminopropylideneamino]-(pentylamino)methylidene]-3-methylidenepyrrol-1-yl]methyl]-3-methoxyphenyl]methoxymethyl]acetamide |
|---|---|
| PubChem CID | 171654132 |
| Molecular Formula | C26H40N6O3 |
| Molecular Weight | 484.65 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | 2-amino-N-[[4-[[(2E)-2-[[(E)-1-aminopropylideneamino]-(pentylamino)methylidene]-3-methylidenepyrrol-1-yl]methyl]-3-methoxyphenyl]methoxymethyl]acetamide |
| SMILES | C=c1ccn(Cc2ccc(COCNC(=O)CN)cc2OC)/c1=C(/N=C(/N)CC)NCCCCC |
| InChI | InChI=1S/C26H40N6O3/c1-5-7-8-12-29-26(31-23(28)6-2)25-19(3)11-13-32(25)16-21-10-9-20(14-22(21)34-4)17-35-18-30-24(33)15-27/h9-11,13-14,29H,3,5-8,12,15-18,27H2,1-2,4H3,(H2,28,31)(H,30,33)/b26-25+ |
| InChIKey | QELUASQUXUBAHH-OCEACIFDSA-N |
| XLogP | 1.12 |
| TPSA | 128.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.65 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|