C30H49N5O5 — CID 171654195
N'-[(E)-[1-[[4-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxymethyl]-2-methoxyphenyl]methyl]-3-methylidenepyrrol-2-ylidene]-(pentylamino)methyl]ethanimidamide (PubChem CID 171654195) has the molecular formula C30H49N5O5 and a molecular weight of 559.75 g/mol. Its IUPAC name is N'-[(E)-[1-[[4-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxymethyl]-2-methoxyphenyl]methyl]-3-methylidenepyrrol-2-ylidene]-(pentylamino)methyl]ethanimidamide.
| Compound Name | N'-[(E)-[1-[[4-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxymethyl]-2-methoxyphenyl]methyl]-3-methylidenepyrrol-2-ylidene]-(pentylamino)methyl]ethanimidamide |
|---|---|
| PubChem CID | 171654195 |
| Molecular Formula | C30H49N5O5 |
| Molecular Weight | 559.75 g/mol |
| Exact Mass | 559.37 |
| IUPAC Name | N'-[(E)-[1-[[4-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxymethyl]-2-methoxyphenyl]methyl]-3-methylidenepyrrol-2-ylidene]-(pentylamino)methyl]ethanimidamide |
| SMILES | C=c1ccn(Cc2ccc(COCCOCCOCCOCCN)cc2OC)/c1=C(/N=C(\C)N)NCCCCC |
| InChI | InChI=1S/C30H49N5O5/c1-5-6-7-12-33-30(34-25(3)32)29-24(2)10-13-35(29)22-27-9-8-26(21-28(27)36-4)23-40-20-19-39-18-17-38-16-15-37-14-11-31/h8-10,13,21,33H,2,5-7,11-12,14-20,22-23,31H2,1,3-4H3,(H2,32,34)/b30-29+ |
| InChIKey | YJSYSFXJSYDIOB-QVIHXGFCSA-N |
| XLogP | 1.70 |
| TPSA | 127.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.75 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|