C29H45N5O4 — CID 171654175
2-[2-[2-[[4-[[(3aZ,7E,9E)-7-amino-9-(pentylamino)-5,6-dihydropyrrolo[2,3-c]azocin-1-yl]methyl]-3-methoxyphenyl]methylamino]ethoxy]ethoxy]ethanol (PubChem CID 171654175) has the molecular formula C29H45N5O4 and a molecular weight of 527.71 g/mol. Its IUPAC name is 2-[2-[2-[[4-[[(3aZ,7E,9E)-7-amino-9-(pentylamino)-5,6-dihydropyrrolo[2,3-c]azocin-1-yl]methyl]-3-methoxyphenyl]methylamino]ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-[[4-[[(3aZ,7E,9E)-7-amino-9-(pentylamino)-5,6-dihydropyrrolo[2,3-c]azocin-1-yl]methyl]-3-methoxyphenyl]methylamino]ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 171654175 |
| Molecular Formula | C29H45N5O4 |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 527.35 |
| IUPAC Name | 2-[2-[2-[[4-[[(3aZ,7E,9E)-7-amino-9-(pentylamino)-5,6-dihydropyrrolo[2,3-c]azocin-1-yl]methyl]-3-methoxyphenyl]methylamino]ethoxy]ethoxy]ethanol |
| SMILES | CCCCCNC1=c2/c(ccn2Cc2ccc(CNCCOCCOCCO)cc2OC)=C\CC/C(N)=N\1 |
| InChI | InChI=1S/C29H45N5O4/c1-3-4-5-12-32-29-28-24(7-6-8-27(30)33-29)11-14-34(28)22-25-10-9-23(20-26(25)36-2)21-31-13-16-37-18-19-38-17-15-35/h7,9-11,14,20,31-32,35H,3-6,8,12-13,15-19,21-22H2,1-2H3,(H2,30,33)/b24-7-,29-28+ |
| InChIKey | AVSIFNYQVPVSBW-AJQKOXPOSA-N |
| XLogP | 1.44 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|