C20H25N9O — CID 118484657
5-[[2-methoxy-5-(2H-tetrazol-5-yl)phenyl]methyl]-4-N-pentylpyrrolo[3,2-d]pyrimidine-2,4-diamine (PubChem CID 118484657) has the molecular formula C20H25N9O and a molecular weight of 407.48 g/mol. Its IUPAC name is 5-[[2-methoxy-5-(2H-tetrazol-5-yl)phenyl]methyl]-4-N-pentylpyrrolo[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 5-[[2-methoxy-5-(2H-tetrazol-5-yl)phenyl]methyl]-4-N-pentylpyrrolo[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 118484657 |
| Molecular Formula | C20H25N9O |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 5-[[2-methoxy-5-(2H-tetrazol-5-yl)phenyl]methyl]-4-N-pentylpyrrolo[3,2-d]pyrimidine-2,4-diamine |
| SMILES | CCCCCNc1nc(N)nc2ccn(Cc3cc(-c4nn[nH]n4)ccc3OC)c12 |
| InChI | InChI=1S/C20H25N9O/c1-3-4-5-9-22-19-17-15(23-20(21)24-19)8-10-29(17)12-14-11-13(6-7-16(14)30-2)18-25-27-28-26-18/h6-8,10-11H,3-5,9,12H2,1-2H3,(H3,21,22,23,24)(H,25,26,27,28) |
| InChIKey | ZMXZKMDODWPMFT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 132.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|