C21H29N9O — CID 118484690
3-hexyl-5-[[2-methoxy-5-(2H-tetrazol-5-yl)phenyl]methyl]-4H-pyrrolo[3,2-d]pyrimidine-2,4-diamine (PubChem CID 118484690) has the molecular formula C21H29N9O and a molecular weight of 423.53 g/mol. Its IUPAC name is 3-hexyl-5-[[2-methoxy-5-(2H-tetrazol-5-yl)phenyl]methyl]-4H-pyrrolo[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 3-hexyl-5-[[2-methoxy-5-(2H-tetrazol-5-yl)phenyl]methyl]-4H-pyrrolo[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 118484690 |
| Molecular Formula | C21H29N9O |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | 3-hexyl-5-[[2-methoxy-5-(2H-tetrazol-5-yl)phenyl]methyl]-4H-pyrrolo[3,2-d]pyrimidine-2,4-diamine |
| SMILES | CCCCCCN1C(N)=Nc2ccn(Cc3cc(-c4nn[nH]n4)ccc3OC)c2C1N |
| InChI | InChI=1S/C21H29N9O/c1-3-4-5-6-10-30-19(22)18-16(24-21(30)23)9-11-29(18)13-15-12-14(7-8-17(15)31-2)20-25-27-28-26-20/h7-9,11-12,19H,3-6,10,13,22H2,1-2H3,(H2,23,24)(H,25,26,27,28) |
| InChIKey | WYDBGXBTOJOKQO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 136.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|