C20H25N5O3 — CID 142797319
[2-amino-4-(pentylamino)pyrrolo[3,2-d]pyrimidin-5-yl]methyl 4-methoxybenzoate (PubChem CID 142797319) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is [2-amino-4-(pentylamino)pyrrolo[3,2-d]pyrimidin-5-yl]methyl 4-methoxybenzoate.
| Compound Name | [2-amino-4-(pentylamino)pyrrolo[3,2-d]pyrimidin-5-yl]methyl 4-methoxybenzoate |
|---|---|
| PubChem CID | 142797319 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | [2-amino-4-(pentylamino)pyrrolo[3,2-d]pyrimidin-5-yl]methyl 4-methoxybenzoate |
| SMILES | CCCCCNc1nc(N)nc2ccn(COC(=O)c3ccc(OC)cc3)c12 |
| InChI | InChI=1S/C20H25N5O3/c1-3-4-5-11-22-18-17-16(23-20(21)24-18)10-12-25(17)13-28-19(26)14-6-8-15(27-2)9-7-14/h6-10,12H,3-5,11,13H2,1-2H3,(H3,21,22,23,24) |
| InChIKey | AMVXBHYQKDXSEY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|