C17H19N5O2 — CID 57042464
methyl 4-[3-(2,4-diaminopyrrolo[3,2-d]pyrimidin-5-yl)propyl]benzoate (PubChem CID 57042464) has the molecular formula C17H19N5O2 and a molecular weight of 325.37 g/mol. Its IUPAC name is methyl 4-[3-(2,4-diaminopyrrolo[3,2-d]pyrimidin-5-yl)propyl]benzoate.
| Compound Name | methyl 4-[3-(2,4-diaminopyrrolo[3,2-d]pyrimidin-5-yl)propyl]benzoate |
|---|---|
| PubChem CID | 57042464 |
| Molecular Formula | C17H19N5O2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | methyl 4-[3-(2,4-diaminopyrrolo[3,2-d]pyrimidin-5-yl)propyl]benzoate |
| SMILES | COC(=O)c1ccc(CCCn2ccc3nc(N)nc(N)c32)cc1 |
| InChI | InChI=1S/C17H19N5O2/c1-24-16(23)12-6-4-11(5-7-12)3-2-9-22-10-8-13-14(22)15(18)21-17(19)20-13/h4-8,10H,2-3,9H2,1H3,(H4,18,19,20,21) |
| InChIKey | OKDABFWYMWTHCL-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 109.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |