C18H24N6O — CID 171654202
5-[[4-(aminomethyl)phenyl]methyl]-4-N-(2-ethoxyethyl)pyrrolo[3,2-d]pyrimidine-2,4-diamine (PubChem CID 171654202) has the molecular formula C18H24N6O and a molecular weight of 340.43 g/mol. Its IUPAC name is 5-[[4-(aminomethyl)phenyl]methyl]-4-N-(2-ethoxyethyl)pyrrolo[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 5-[[4-(aminomethyl)phenyl]methyl]-4-N-(2-ethoxyethyl)pyrrolo[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 171654202 |
| Molecular Formula | C18H24N6O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 5-[[4-(aminomethyl)phenyl]methyl]-4-N-(2-ethoxyethyl)pyrrolo[3,2-d]pyrimidine-2,4-diamine |
| SMILES | CCOCCNc1nc(N)nc2ccn(Cc3ccc(CN)cc3)c12 |
| InChI | InChI=1S/C18H24N6O/c1-2-25-10-8-21-17-16-15(22-18(20)23-17)7-9-24(16)12-14-5-3-13(11-19)4-6-14/h3-7,9H,2,8,10-12,19H2,1H3,(H3,20,21,22,23) |
| InChIKey | GTXXLVUDFZZGPZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 104.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|