C25H33N7O3 — CID 168916856
2-amino-4-(butylamino)-6-[[3-methoxy-4-(4-methylpiperazine-1-carbonyl)phenyl]methyl]pyrido[4,3-d]pyrimidin-5-one (PubChem CID 168916856) has the molecular formula C25H33N7O3 and a molecular weight of 479.59 g/mol. Its IUPAC name is 2-amino-4-(butylamino)-6-[[3-methoxy-4-(4-methylpiperazine-1-carbonyl)phenyl]methyl]pyrido[4,3-d]pyrimidin-5-one.
| Compound Name | 2-amino-4-(butylamino)-6-[[3-methoxy-4-(4-methylpiperazine-1-carbonyl)phenyl]methyl]pyrido[4,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 168916856 |
| Molecular Formula | C25H33N7O3 |
| Molecular Weight | 479.59 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | 2-amino-4-(butylamino)-6-[[3-methoxy-4-(4-methylpiperazine-1-carbonyl)phenyl]methyl]pyrido[4,3-d]pyrimidin-5-one |
| SMILES | CCCCNc1nc(N)nc2ccn(Cc3ccc(C(=O)N4CCN(C)CC4)c(OC)c3)c(=O)c12 |
| InChI | InChI=1S/C25H33N7O3/c1-4-5-9-27-22-21-19(28-25(26)29-22)8-10-32(24(21)34)16-17-6-7-18(20(15-17)35-3)23(33)31-13-11-30(2)12-14-31/h6-8,10,15H,4-5,9,11-14,16H2,1-3H3,(H3,26,27,28,29) |
| InChIKey | CMVGQYHVEFRKKO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 118.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.59 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|