C22H29N7O3S — CID 168916871
2-amino-4-(butylamino)-6-[(4-piperazin-1-ylsulfonylphenyl)methyl]pyrido[4,3-d]pyrimidin-5-one (PubChem CID 168916871) has the molecular formula C22H29N7O3S and a molecular weight of 471.59 g/mol. Its IUPAC name is 2-amino-4-(butylamino)-6-[(4-piperazin-1-ylsulfonylphenyl)methyl]pyrido[4,3-d]pyrimidin-5-one.
| Compound Name | 2-amino-4-(butylamino)-6-[(4-piperazin-1-ylsulfonylphenyl)methyl]pyrido[4,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 168916871 |
| Molecular Formula | C22H29N7O3S |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | 2-amino-4-(butylamino)-6-[(4-piperazin-1-ylsulfonylphenyl)methyl]pyrido[4,3-d]pyrimidin-5-one |
| SMILES | CCCCNc1nc(N)nc2ccn(Cc3ccc(S(=O)(=O)N4CCNCC4)cc3)c(=O)c12 |
| InChI | InChI=1S/C22H29N7O3S/c1-2-3-9-25-20-19-18(26-22(23)27-20)8-12-28(21(19)30)15-16-4-6-17(7-5-16)33(31,32)29-13-10-24-11-14-29/h4-8,12,24H,2-3,9-11,13-15H2,1H3,(H3,23,25,26,27) |
| InChIKey | WYIUCFPXQZFYLP-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 135.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|