About 5-(1,4-diazepan-1-ylsulfonyl)-2-[(4-fluorophenyl)methyl]isoquinolin-1-one;hydrochloride
5-(1,4-diazepan-1-ylsulfonyl)-2-[(4-fluorophenyl)methyl]isoquinolin-1-one;hydrochloride (PubChem CID 24757586) has the molecular formula C21H23ClFN3O3S
and a molecular weight of 451.95 g/mol. Its IUPAC name is 5-(1,4-diazepan-1-ylsulfonyl)-2-[(4-fluorophenyl)methyl]isoquinolin-1-one;hydrochloride.
Molecular Properties
| Compound Name | 5-(1,4-diazepan-1-ylsulfonyl)-2-[(4-fluorophenyl)methyl]isoquinolin-1-one;hydrochloride |
| PubChem CID | 24757586 |
| Molecular Formula | C21H23ClFN3O3S |
| Molecular Weight | 451.95 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 5-(1,4-diazepan-1-ylsulfonyl)-2-[(4-fluorophenyl)methyl]isoquinolin-1-one;hydrochloride |
| SMILES | Cl.O=c1c2cccc(S(=O)(=O)N3CCCNCC3)c2ccn1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C21H22FN3O3S.ClH/c22-17-7-5-16(6-8-17)15-24-13-9-18-19(21(24)26)3-1-4-20(18)29(27,28)25-12-2-10-23-11-14-25;/h1,3-9,13,23H,2,10-12,14-15H2;1H |
| InChIKey | VTTNBGFBSBYOJU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.95 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(1,4-diazepan-1-ylsulfonyl)-2-[(4-fluorophenyl)methyl]isoquinolin-1-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,4-diazepan-1-ylsulfonyl)-2-[(4-fluorophenyl)methyl]isoquinolin-1-one;hydrochloride?
The IUPAC name of 5-(1,4-diazepan-1-ylsulfonyl)-2-[(4-fluorophenyl)methyl]isoquinolin-1-one;hydrochloride (CID 24757586) is 5-(1,4-diazepan-1-ylsulfonyl)-2-[(4-fluorophenyl)methyl]isoquinolin-1-one;hydrochloride.
What is the SMILES notation for 5-(1,4-diazepan-1-ylsulfonyl)-2-[(4-fluorophenyl)methyl]isoquinolin-1-one;hydrochloride?
The canonical SMILES for 5-(1,4-diazepan-1-ylsulfonyl)-2-[(4-fluorophenyl)methyl]isoquinolin-1-one;hydrochloride is Cl.O=c1c2cccc(S(=O)(=O)N3CCCNCC3)c2ccn1Cc1ccc(F)cc1.
What is the InChIKey of 5-(1,4-diazepan-1-ylsulfonyl)-2-[(4-fluorophenyl)methyl]isoquinolin-1-one;hydrochloride?
The InChIKey is VTTNBGFBSBYOJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22FN3O3S.ClH/c22-17-7-5-16(6-8-17)15-24-13-9-18-19(21(24)26)3-1-4-20(18)29(27,28)25-12-2-10-23-11-14-25;/h1,3-9,13,23H,2,10-12,14-15H2;1H.
What are the key properties of 5-(1,4-diazepan-1-ylsulfonyl)-2-[(4-fluorophenyl)methyl]isoquinolin-1-one;hydrochloride?
5-(1,4-diazepan-1-ylsulfonyl)-2-[(4-fluorophenyl)methyl]isoquinolin-1-one;hydrochloride has a molecular weight of 451.95 g/mol, XLogP of 2.59, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,4-diazepan-1-ylsulfonyl)-2-[(4-fluorophenyl)methyl]isoquinolin-1-one;hydrochloride is sourced from PubChem (CID 24757586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).