C22H25N3O3S — CID 24757591
2-benzyl-5-(1,4-diazepan-1-ylsulfonyl)-4-methylisoquinolin-1-one (PubChem CID 24757591) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is 2-benzyl-5-(1,4-diazepan-1-ylsulfonyl)-4-methylisoquinolin-1-one.
| Compound Name | 2-benzyl-5-(1,4-diazepan-1-ylsulfonyl)-4-methylisoquinolin-1-one |
|---|---|
| PubChem CID | 24757591 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 2-benzyl-5-(1,4-diazepan-1-ylsulfonyl)-4-methylisoquinolin-1-one |
| SMILES | Cc1cn(Cc2ccccc2)c(=O)c2cccc(S(=O)(=O)N3CCCNCC3)c12 |
| InChI | InChI=1S/C22H25N3O3S/c1-17-15-24(16-18-7-3-2-4-8-18)22(26)19-9-5-10-20(21(17)19)29(27,28)25-13-6-11-23-12-14-25/h2-5,7-10,15,23H,6,11-14,16H2,1H3 |
| InChIKey | HWUQYRBIBYRJFW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |