C19H28N4O2S — CID 158195809
1-(5-methylnaphthalen-1-yl)sulfonyl-1,4,7,10-tetrazacyclododecane (PubChem CID 158195809) has the molecular formula C19H28N4O2S and a molecular weight of 376.53 g/mol. Its IUPAC name is 1-(5-methylnaphthalen-1-yl)sulfonyl-1,4,7,10-tetrazacyclododecane.
| Compound Name | 1-(5-methylnaphthalen-1-yl)sulfonyl-1,4,7,10-tetrazacyclododecane |
|---|---|
| PubChem CID | 158195809 |
| Molecular Formula | C19H28N4O2S |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 1-(5-methylnaphthalen-1-yl)sulfonyl-1,4,7,10-tetrazacyclododecane |
| SMILES | Cc1cccc2c(S(=O)(=O)N3CCNCCNCCNCC3)cccc12 |
| InChI | InChI=1S/C19H28N4O2S/c1-16-4-2-6-18-17(16)5-3-7-19(18)26(24,25)23-14-12-21-10-8-20-9-11-22-13-15-23/h2-7,20-22H,8-15H2,1H3 |
| InChIKey | NDHVKHJKEYTTFS-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |