C18H25N3O3S — CID 70194721
5-(1,4-diazepan-1-ylsulfonyl)-4-methyl-1-propoxyisoquinoline (PubChem CID 70194721) has the molecular formula C18H25N3O3S and a molecular weight of 363.48 g/mol. Its IUPAC name is 5-(1,4-diazepan-1-ylsulfonyl)-4-methyl-1-propoxyisoquinoline.
| Compound Name | 5-(1,4-diazepan-1-ylsulfonyl)-4-methyl-1-propoxyisoquinoline |
|---|---|
| PubChem CID | 70194721 |
| Molecular Formula | C18H25N3O3S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 5-(1,4-diazepan-1-ylsulfonyl)-4-methyl-1-propoxyisoquinoline |
| SMILES | CCCOc1ncc(C)c2c(S(=O)(=O)N3CCCNCC3)cccc12 |
| InChI | InChI=1S/C18H25N3O3S/c1-3-12-24-18-15-6-4-7-16(17(15)14(2)13-20-18)25(22,23)21-10-5-8-19-9-11-21/h4,6-7,13,19H,3,5,8-12H2,1-2H3 |
| InChIKey | MWVCXAUAWLAEEQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |