C25H35N7O — CID 170186115
2-amino-4-(butylamino)-6-[[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]pyrido[4,3-d]pyrimidin-5-one (PubChem CID 170186115) has the molecular formula C25H35N7O and a molecular weight of 449.60 g/mol. Its IUPAC name is 2-amino-4-(butylamino)-6-[[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]pyrido[4,3-d]pyrimidin-5-one.
| Compound Name | 2-amino-4-(butylamino)-6-[[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]pyrido[4,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 170186115 |
| Molecular Formula | C25H35N7O |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.29 |
| IUPAC Name | 2-amino-4-(butylamino)-6-[[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]pyrido[4,3-d]pyrimidin-5-one |
| SMILES | CCCCNc1nc(N)nc2ccn(Cc3ccc(CN4CCN(CC)CC4)cc3)c(=O)c12 |
| InChI | InChI=1S/C25H35N7O/c1-3-5-11-27-23-22-21(28-25(26)29-23)10-12-32(24(22)33)18-20-8-6-19(7-9-20)17-31-15-13-30(4-2)14-16-31/h6-10,12H,3-5,11,13-18H2,1-2H3,(H3,26,27,28,29) |
| InChIKey | MKJLEUYUVOPGLC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 92.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|