C22H30N8O — CID 169192924
2-amino-4-(butylamino)-6-[[4-(piperazin-1-ylmethyl)phenyl]methyl]pyrimido[4,5-d]pyridazin-5-one (PubChem CID 169192924) has the molecular formula C22H30N8O and a molecular weight of 422.54 g/mol. Its IUPAC name is 2-amino-4-(butylamino)-6-[[4-(piperazin-1-ylmethyl)phenyl]methyl]pyrimido[4,5-d]pyridazin-5-one.
| Compound Name | 2-amino-4-(butylamino)-6-[[4-(piperazin-1-ylmethyl)phenyl]methyl]pyrimido[4,5-d]pyridazin-5-one |
|---|---|
| PubChem CID | 169192924 |
| Molecular Formula | C22H30N8O |
| Molecular Weight | 422.54 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | 2-amino-4-(butylamino)-6-[[4-(piperazin-1-ylmethyl)phenyl]methyl]pyrimido[4,5-d]pyridazin-5-one |
| SMILES | CCCCNc1nc(N)nc2cnn(Cc3ccc(CN4CCNCC4)cc3)c(=O)c12 |
| InChI | InChI=1S/C22H30N8O/c1-2-3-8-25-20-19-18(27-22(23)28-20)13-26-30(21(19)31)15-17-6-4-16(5-7-17)14-29-11-9-24-10-12-29/h4-7,13,24H,2-3,8-12,14-15H2,1H3,(H3,23,25,27,28) |
| InChIKey | WUNZGZTXHYGSEA-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 113.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.54 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|