C31H48N7O4P — CID 170186565
2-amino-4-(butylamino)-6-[[4-[[4-(4-diethoxyphosphorylbutyl)piperazin-1-yl]methyl]phenyl]methyl]pyrido[4,3-d]pyrimidin-5-one (PubChem CID 170186565) has the molecular formula C31H48N7O4P and a molecular weight of 613.74 g/mol. Its IUPAC name is 2-amino-4-(butylamino)-6-[[4-[[4-(4-diethoxyphosphorylbutyl)piperazin-1-yl]methyl]phenyl]methyl]pyrido[4,3-d]pyrimidin-5-one.
| Compound Name | 2-amino-4-(butylamino)-6-[[4-[[4-(4-diethoxyphosphorylbutyl)piperazin-1-yl]methyl]phenyl]methyl]pyrido[4,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 170186565 |
| Molecular Formula | C31H48N7O4P |
| Molecular Weight | 613.74 g/mol |
| Exact Mass | 613.35 |
| IUPAC Name | 2-amino-4-(butylamino)-6-[[4-[[4-(4-diethoxyphosphorylbutyl)piperazin-1-yl]methyl]phenyl]methyl]pyrido[4,3-d]pyrimidin-5-one |
| SMILES | CCCCNc1nc(N)nc2ccn(Cc3ccc(CN4CCN(CCCCP(=O)(OCC)OCC)CC4)cc3)c(=O)c12 |
| InChI | InChI=1S/C31H48N7O4P/c1-4-7-15-33-29-28-27(34-31(32)35-29)14-17-38(30(28)39)24-26-12-10-25(11-13-26)23-37-20-18-36(19-21-37)16-8-9-22-43(40,41-5-2)42-6-3/h10-14,17H,4-9,15-16,18-24H2,1-3H3,(H3,32,33,34,35) |
| InChIKey | YKZIWFKLAXGPFB-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.74 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|