C21H34N6O — CID 171084067
2-amino-4-(butylamino)-6-[[4-[(dimethylamino)methyl]cyclohexyl]methyl]pyrido[4,3-d]pyrimidin-5-one (PubChem CID 171084067) has the molecular formula C21H34N6O and a molecular weight of 386.54 g/mol. Its IUPAC name is 2-amino-4-(butylamino)-6-[[4-[(dimethylamino)methyl]cyclohexyl]methyl]pyrido[4,3-d]pyrimidin-5-one.
| Compound Name | 2-amino-4-(butylamino)-6-[[4-[(dimethylamino)methyl]cyclohexyl]methyl]pyrido[4,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 171084067 |
| Molecular Formula | C21H34N6O |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | 2-amino-4-(butylamino)-6-[[4-[(dimethylamino)methyl]cyclohexyl]methyl]pyrido[4,3-d]pyrimidin-5-one |
| SMILES | CCCCNc1nc(N)nc2ccn(CC3CCC(CN(C)C)CC3)c(=O)c12 |
| InChI | InChI=1S/C21H34N6O/c1-4-5-11-23-19-18-17(24-21(22)25-19)10-12-27(20(18)28)14-16-8-6-15(7-9-16)13-26(2)3/h10,12,15-16H,4-9,11,13-14H2,1-3H3,(H3,22,23,24,25) |
| InChIKey | FWQFGJIIEMQNTA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|