C15H22N4OS — CID 158505889
(5R)-5-[(2-aminothieno[3,2-d]pyrimidin-4-yl)amino]nonan-2-one (PubChem CID 158505889) has the molecular formula C15H22N4OS and a molecular weight of 306.44 g/mol. Its IUPAC name is (5R)-5-[(2-aminothieno[3,2-d]pyrimidin-4-yl)amino]nonan-2-one.
| Compound Name | (5R)-5-[(2-aminothieno[3,2-d]pyrimidin-4-yl)amino]nonan-2-one |
|---|---|
| PubChem CID | 158505889 |
| Molecular Formula | C15H22N4OS |
| Molecular Weight | 306.44 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | (5R)-5-[(2-aminothieno[3,2-d]pyrimidin-4-yl)amino]nonan-2-one |
| SMILES | CCCC[C@H](CCC(C)=O)Nc1nc(N)nc2ccsc12 |
| InChI | InChI=1S/C15H22N4OS/c1-3-4-5-11(7-6-10(2)20)17-14-13-12(8-9-21-13)18-15(16)19-14/h8-9,11H,3-7H2,1-2H3,(H3,16,17,18,19)/t11-/m1/s1 |
| InChIKey | VLBIMLVDVSHRTM-LLVKDONJSA-N |
| XLogP | 3.61 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |