C12H18N4S — CID 112750443
4-N-(2-methylpentan-3-yl)thieno[3,2-d]pyrimidine-2,4-diamine (PubChem CID 112750443) has the molecular formula C12H18N4S and a molecular weight of 250.37 g/mol. Its IUPAC name is 4-N-(2-methylpentan-3-yl)thieno[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(2-methylpentan-3-yl)thieno[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112750443 |
| Molecular Formula | C12H18N4S |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 4-N-(2-methylpentan-3-yl)thieno[3,2-d]pyrimidine-2,4-diamine |
| SMILES | CCC(Nc1nc(N)nc2ccsc12)C(C)C |
| InChI | InChI=1S/C12H18N4S/c1-4-8(7(2)3)14-11-10-9(5-6-17-10)15-12(13)16-11/h5-8H,4H2,1-3H3,(H3,13,14,15,16) |
| InChIKey | PBVBTLKACVDSID-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |