C15H22N6O — CID 122585199
N-[2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]hexyl]acetamide (PubChem CID 122585199) has the molecular formula C15H22N6O and a molecular weight of 302.38 g/mol. Its IUPAC name is N-[2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]hexyl]acetamide.
| Compound Name | N-[2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]hexyl]acetamide |
|---|---|
| PubChem CID | 122585199 |
| Molecular Formula | C15H22N6O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | N-[2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]hexyl]acetamide |
| SMILES | CCCCC(CNC(C)=O)Nc1nc(N)nc2cccnc12 |
| InChI | InChI=1S/C15H22N6O/c1-3-4-6-11(9-18-10(2)22)19-14-13-12(7-5-8-17-13)20-15(16)21-14/h5,7-8,11H,3-4,6,9H2,1-2H3,(H,18,22)(H3,16,19,20,21) |
| InChIKey | PEHSSHJVQCZAMK-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |