About N-[2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]hexyl]acetamide
N-[2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]hexyl]acetamide (PubChem CID 122585199) has the molecular formula C15H22N6O
and a molecular weight of 302.38 g/mol. Its IUPAC name is N-[2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]hexyl]acetamide.
Molecular Properties
| Compound Name | N-[2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]hexyl]acetamide |
| PubChem CID | 122585199 |
| Molecular Formula | C15H22N6O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | N-[2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]hexyl]acetamide |
| SMILES | CCCCC(CNC(C)=O)Nc1nc(N)nc2cccnc12 |
| InChI | InChI=1S/C15H22N6O/c1-3-4-6-11(9-18-10(2)22)19-14-13-12(7-5-8-17-13)20-15(16)21-14/h5,7-8,11H,3-4,6,9H2,1-2H3,(H,18,22)(H3,16,19,20,21) |
| InChIKey | PEHSSHJVQCZAMK-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]hexyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]hexyl]acetamide?
The IUPAC name of N-[2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]hexyl]acetamide (CID 122585199) is N-[2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]hexyl]acetamide.
What is the SMILES notation for N-[2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]hexyl]acetamide?
The canonical SMILES for N-[2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]hexyl]acetamide is CCCCC(CNC(C)=O)Nc1nc(N)nc2cccnc12.
What is the InChIKey of N-[2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]hexyl]acetamide?
The InChIKey is PEHSSHJVQCZAMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N6O/c1-3-4-6-11(9-18-10(2)22)19-14-13-12(7-5-8-17-13)20-15(16)21-14/h5,7-8,11H,3-4,6,9H2,1-2H3,(H,18,22)(H3,16,19,20,21).
What are the key properties of N-[2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]hexyl]acetamide?
N-[2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]hexyl]acetamide has a molecular weight of 302.38 g/mol, XLogP of 1.71, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]hexyl]acetamide is sourced from PubChem (CID 122585199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).