C15H23N5 — CID 122598680
4-N-(3-methylheptan-3-yl)pyrido[3,2-d]pyrimidine-2,4-diamine (PubChem CID 122598680) has the molecular formula C15H23N5 and a molecular weight of 273.38 g/mol. Its IUPAC name is 4-N-(3-methylheptan-3-yl)pyrido[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(3-methylheptan-3-yl)pyrido[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 122598680 |
| Molecular Formula | C15H23N5 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.20 |
| IUPAC Name | 4-N-(3-methylheptan-3-yl)pyrido[3,2-d]pyrimidine-2,4-diamine |
| SMILES | CCCCC(C)(CC)Nc1nc(N)nc2cccnc12 |
| InChI | InChI=1S/C15H23N5/c1-4-6-9-15(3,5-2)20-13-12-11(8-7-10-17-12)18-14(16)19-13/h7-8,10H,4-6,9H2,1-3H3,(H3,16,18,19,20) |
| InChIKey | NXXFDOPVWFGIBS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |