C14H21N5 — CID 122598693
4-N-[(3S)-3-methylhexan-3-yl]pyrido[3,2-d]pyrimidine-2,4-diamine (PubChem CID 122598693) has the molecular formula C14H21N5 and a molecular weight of 259.36 g/mol. Its IUPAC name is 4-N-[(3S)-3-methylhexan-3-yl]pyrido[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-[(3S)-3-methylhexan-3-yl]pyrido[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 122598693 |
| Molecular Formula | C14H21N5 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | 4-N-[(3S)-3-methylhexan-3-yl]pyrido[3,2-d]pyrimidine-2,4-diamine |
| SMILES | CCC[C@](C)(CC)Nc1nc(N)nc2cccnc12 |
| InChI | InChI=1S/C14H21N5/c1-4-8-14(3,5-2)19-12-11-10(7-6-9-16-11)17-13(15)18-12/h6-7,9H,4-5,8H2,1-3H3,(H3,15,17,18,19)/t14-/m0/s1 |
| InChIKey | HCPBPDLFOBBEMN-AWEZNQCLSA-N |
| XLogP | 2.99 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |