C17H26N6O — CID 122585361
N-[2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-methylheptyl]acetamide (PubChem CID 122585361) has the molecular formula C17H26N6O and a molecular weight of 330.44 g/mol. Its IUPAC name is N-[2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-methylheptyl]acetamide.
| Compound Name | N-[2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-methylheptyl]acetamide |
|---|---|
| PubChem CID | 122585361 |
| Molecular Formula | C17H26N6O |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | N-[2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-methylheptyl]acetamide |
| SMILES | CCCCCC(C)(CNC(C)=O)Nc1nc(N)nc2cccnc12 |
| InChI | InChI=1S/C17H26N6O/c1-4-5-6-9-17(3,11-20-12(2)24)23-15-14-13(8-7-10-19-14)21-16(18)22-15/h7-8,10H,4-6,9,11H2,1-3H3,(H,20,24)(H3,18,21,22,23) |
| InChIKey | HBZVREOSVDFLLI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|