C15H23N7O — CID 134305672
N-[2-[(2-aminopteridin-4-yl)amino]-2-methylhexyl]acetamide (PubChem CID 134305672) has the molecular formula C15H23N7O and a molecular weight of 317.40 g/mol. Its IUPAC name is N-[2-[(2-aminopteridin-4-yl)amino]-2-methylhexyl]acetamide.
| Compound Name | N-[2-[(2-aminopteridin-4-yl)amino]-2-methylhexyl]acetamide |
|---|---|
| PubChem CID | 134305672 |
| Molecular Formula | C15H23N7O |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | N-[2-[(2-aminopteridin-4-yl)amino]-2-methylhexyl]acetamide |
| SMILES | CCCCC(C)(CNC(C)=O)Nc1nc(N)nc2nccnc12 |
| InChI | InChI=1S/C15H23N7O/c1-4-5-6-15(3,9-19-10(2)23)22-13-11-12(18-8-7-17-11)20-14(16)21-13/h7-8H,4-6,9H2,1-3H3,(H,19,23)(H3,16,18,20,21,22) |
| InChIKey | ZCOMAVAZOVGSLD-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 118.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |