C18H25ClN4O — CID 157159263
(5R)-5-[(2-chloropyrido[3,2-d]pyrimidin-4-yl)amino]-5-methyldecan-2-one (PubChem CID 157159263) has the molecular formula C18H25ClN4O and a molecular weight of 348.88 g/mol. Its IUPAC name is (5R)-5-[(2-chloropyrido[3,2-d]pyrimidin-4-yl)amino]-5-methyldecan-2-one.
| Compound Name | (5R)-5-[(2-chloropyrido[3,2-d]pyrimidin-4-yl)amino]-5-methyldecan-2-one |
|---|---|
| PubChem CID | 157159263 |
| Molecular Formula | C18H25ClN4O |
| Molecular Weight | 348.88 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | (5R)-5-[(2-chloropyrido[3,2-d]pyrimidin-4-yl)amino]-5-methyldecan-2-one |
| SMILES | CCCCC[C@](C)(CCC(C)=O)Nc1nc(Cl)nc2cccnc12 |
| InChI | InChI=1S/C18H25ClN4O/c1-4-5-6-10-18(3,11-9-13(2)24)23-16-15-14(8-7-12-20-15)21-17(19)22-16/h7-8,12H,4-6,9-11H2,1-3H3,(H,21,22,23)/t18-/m1/s1 |
| InChIKey | UNMMYFPVLGWXCK-GOSISDBHSA-N |
| XLogP | 4.80 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.88 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|