C17H23ClN4O — CID 159037755
(5R)-5-[(2-chloropyrido[3,4-d]pyrimidin-4-yl)amino]-5-methylnonan-2-one (PubChem CID 159037755) has the molecular formula C17H23ClN4O and a molecular weight of 334.85 g/mol. Its IUPAC name is (5R)-5-[(2-chloropyrido[3,4-d]pyrimidin-4-yl)amino]-5-methylnonan-2-one.
| Compound Name | (5R)-5-[(2-chloropyrido[3,4-d]pyrimidin-4-yl)amino]-5-methylnonan-2-one |
|---|---|
| PubChem CID | 159037755 |
| Molecular Formula | C17H23ClN4O |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | (5R)-5-[(2-chloropyrido[3,4-d]pyrimidin-4-yl)amino]-5-methylnonan-2-one |
| SMILES | CCCC[C@](C)(CCC(C)=O)Nc1nc(Cl)nc2cnccc12 |
| InChI | InChI=1S/C17H23ClN4O/c1-4-5-8-17(3,9-6-12(2)23)22-15-13-7-10-19-11-14(13)20-16(18)21-15/h7,10-11H,4-6,8-9H2,1-3H3,(H,20,21,22)/t17-/m1/s1 |
| InChIKey | MSQKZKDILUUTLL-QGZVFWFLSA-N |
| XLogP | 4.41 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |