C15H23N5 — CID 171782266
4-N-(1-amino-2-methylhexan-2-yl)-1,5-naphthyridine-2,4-diamine (PubChem CID 171782266) has the molecular formula C15H23N5 and a molecular weight of 273.38 g/mol. Its IUPAC name is 4-N-(1-amino-2-methylhexan-2-yl)-1,5-naphthyridine-2,4-diamine.
| Compound Name | 4-N-(1-amino-2-methylhexan-2-yl)-1,5-naphthyridine-2,4-diamine |
|---|---|
| PubChem CID | 171782266 |
| Molecular Formula | C15H23N5 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.20 |
| IUPAC Name | 4-N-(1-amino-2-methylhexan-2-yl)-1,5-naphthyridine-2,4-diamine |
| SMILES | CCCCC(C)(CN)Nc1cc(N)nc2cccnc12 |
| InChI | InChI=1S/C15H23N5/c1-3-4-7-15(2,10-16)20-12-9-13(17)19-11-6-5-8-18-14(11)12/h5-6,8-9H,3-4,7,10,16H2,1-2H3,(H3,17,19,20) |
| InChIKey | NLCPXXZCRFJAFL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |