C15H14N4 — CID 91308709
4-N-benzyl-1,5-naphthyridine-2,4-diamine (PubChem CID 91308709) has the molecular formula C15H14N4 and a molecular weight of 250.31 g/mol. Its IUPAC name is 4-N-benzyl-1,5-naphthyridine-2,4-diamine.
| Compound Name | 4-N-benzyl-1,5-naphthyridine-2,4-diamine |
|---|---|
| PubChem CID | 91308709 |
| Molecular Formula | C15H14N4 |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 4-N-benzyl-1,5-naphthyridine-2,4-diamine |
| SMILES | Nc1cc(NCc2ccccc2)c2ncccc2n1 |
| InChI | InChI=1S/C15H14N4/c16-14-9-13(15-12(19-14)7-4-8-17-15)18-10-11-5-2-1-3-6-11/h1-9H,10H2,(H3,16,18,19) |
| InChIKey | OTHCUILNNWFEBL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |