C17H17N5O — CID 154039588
4-[[(2-aminoquinolin-4-yl)amino]methyl]-N'-hydroxybenzenecarboximidamide (PubChem CID 154039588) has the molecular formula C17H17N5O and a molecular weight of 307.36 g/mol. Its IUPAC name is 4-[[(2-aminoquinolin-4-yl)amino]methyl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-[[(2-aminoquinolin-4-yl)amino]methyl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 154039588 |
| Molecular Formula | C17H17N5O |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 4-[[(2-aminoquinolin-4-yl)amino]methyl]-N'-hydroxybenzenecarboximidamide |
| SMILES | NC(=NO)c1ccc(CNc2cc(N)nc3ccccc23)cc1 |
| InChI | InChI=1S/C17H17N5O/c18-16-9-15(13-3-1-2-4-14(13)21-16)20-10-11-5-7-12(8-6-11)17(19)22-23/h1-9,23H,10H2,(H2,19,22)(H3,18,20,21) |
| InChIKey | DYNWBQMTHJARCN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 109.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|