C14H21N3S — CID 114138437
N-octan-4-ylthieno[3,2-d]pyrimidin-4-amine (PubChem CID 114138437) has the molecular formula C14H21N3S and a molecular weight of 263.41 g/mol. Its IUPAC name is N-octan-4-ylthieno[3,2-d]pyrimidin-4-amine.
| Compound Name | N-octan-4-ylthieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 114138437 |
| Molecular Formula | C14H21N3S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | N-octan-4-ylthieno[3,2-d]pyrimidin-4-amine |
| SMILES | CCCCC(CCC)Nc1ncnc2ccsc12 |
| InChI | InChI=1S/C14H21N3S/c1-3-5-7-11(6-4-2)17-14-13-12(8-9-18-13)15-10-16-14/h8-11H,3-7H2,1-2H3,(H,15,16,17) |
| InChIKey | OCDXDJWOBPLISP-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |