C15H25N3 — CID 114138445
N-octan-4-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine (PubChem CID 114138445) has the molecular formula C15H25N3 and a molecular weight of 247.39 g/mol. Its IUPAC name is N-octan-4-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine.
| Compound Name | N-octan-4-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 114138445 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | N-octan-4-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine |
| SMILES | CCCCC(CCC)Nc1ncnc2c1CCC2 |
| InChI | InChI=1S/C15H25N3/c1-3-5-8-12(7-4-2)18-15-13-9-6-10-14(13)16-11-17-15/h11-12H,3-10H2,1-2H3,(H,16,17,18) |
| InChIKey | TZSRDGIHDFAGFL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |