C13H21N3 — CID 63184554
N-hexyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine (PubChem CID 63184554) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is N-hexyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine.
| Compound Name | N-hexyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 63184554 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | N-hexyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine |
| SMILES | CCCCCCNc1ncnc2c1CCC2 |
| InChI | InChI=1S/C13H21N3/c1-2-3-4-5-9-14-13-11-7-6-8-12(11)15-10-16-13/h10H,2-9H2,1H3,(H,14,15,16) |
| InChIKey | ZPOOEBGWRNUXBF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|