C13H18F3N3 — CID 115486566
N-(5,5,5-trifluoropentyl)-5,6,7,8-tetrahydroquinazolin-4-amine (PubChem CID 115486566) has the molecular formula C13H18F3N3 and a molecular weight of 273.30 g/mol. Its IUPAC name is N-(5,5,5-trifluoropentyl)-5,6,7,8-tetrahydroquinazolin-4-amine.
| Compound Name | N-(5,5,5-trifluoropentyl)-5,6,7,8-tetrahydroquinazolin-4-amine |
|---|---|
| PubChem CID | 115486566 |
| Molecular Formula | C13H18F3N3 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | N-(5,5,5-trifluoropentyl)-5,6,7,8-tetrahydroquinazolin-4-amine |
| SMILES | FC(F)(F)CCCCNc1ncnc2c1CCCC2 |
| InChI | InChI=1S/C13H18F3N3/c14-13(15,16)7-3-4-8-17-12-10-5-1-2-6-11(10)18-9-19-12/h9H,1-8H2,(H,17,18,19) |
| InChIKey | HDQQFHRDKWCCSK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|