C16H19N3 — CID 55121312
N-(3-phenylpropyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine (PubChem CID 55121312) has the molecular formula C16H19N3 and a molecular weight of 253.35 g/mol. Its IUPAC name is N-(3-phenylpropyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine.
| Compound Name | N-(3-phenylpropyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 55121312 |
| Molecular Formula | C16H19N3 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | N-(3-phenylpropyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine |
| SMILES | c1ccc(CCCNc2ncnc3c2CCC3)cc1 |
| InChI | InChI=1S/C16H19N3/c1-2-6-13(7-3-1)8-5-11-17-16-14-9-4-10-15(14)18-12-19-16/h1-3,6-7,12H,4-5,8-11H2,(H,17,18,19) |
| InChIKey | VFDWVEDTMLOEQI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|