C12H18N4 — CID 62832253
N-cyclopropyl-N'-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)ethane-1,2-diamine (PubChem CID 62832253) has the molecular formula C12H18N4 and a molecular weight of 218.30 g/mol. Its IUPAC name is N-cyclopropyl-N'-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)ethane-1,2-diamine.
| Compound Name | N-cyclopropyl-N'-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62832253 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | N-cyclopropyl-N'-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)ethane-1,2-diamine |
| SMILES | c1nc2c(c(NCCNC3CC3)n1)CCC2 |
| InChI | InChI=1S/C12H18N4/c1-2-10-11(3-1)15-8-16-12(10)14-7-6-13-9-4-5-9/h8-9,13H,1-7H2,(H,14,15,16) |
| InChIKey | RVLGGXCGCXXKDZ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|