C15H23N3O — CID 103990755
N-[2-(oxan-2-yl)ethyl]-5,6,7,8-tetrahydroquinazolin-4-amine (PubChem CID 103990755) has the molecular formula C15H23N3O and a molecular weight of 261.37 g/mol. Its IUPAC name is N-[2-(oxan-2-yl)ethyl]-5,6,7,8-tetrahydroquinazolin-4-amine.
| Compound Name | N-[2-(oxan-2-yl)ethyl]-5,6,7,8-tetrahydroquinazolin-4-amine |
|---|---|
| PubChem CID | 103990755 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | N-[2-(oxan-2-yl)ethyl]-5,6,7,8-tetrahydroquinazolin-4-amine |
| SMILES | c1nc2c(c(NCCC3CCCCO3)n1)CCCC2 |
| InChI | InChI=1S/C15H23N3O/c1-2-7-14-13(6-1)15(18-11-17-14)16-9-8-12-5-3-4-10-19-12/h11-12H,1-10H2,(H,16,17,18) |
| InChIKey | IEGHQANEWKVWSD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |