C12H15N3O3S — CID 81078600
5-methoxy-2-(thieno[3,2-d]pyrimidin-4-ylamino)pentanoic acid (PubChem CID 81078600) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is 5-methoxy-2-(thieno[3,2-d]pyrimidin-4-ylamino)pentanoic acid.
| Compound Name | 5-methoxy-2-(thieno[3,2-d]pyrimidin-4-ylamino)pentanoic acid |
|---|---|
| PubChem CID | 81078600 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 5-methoxy-2-(thieno[3,2-d]pyrimidin-4-ylamino)pentanoic acid |
| SMILES | COCCCC(Nc1ncnc2ccsc12)C(=O)O |
| InChI | InChI=1S/C12H15N3O3S/c1-18-5-2-3-9(12(16)17)15-11-10-8(4-6-19-10)13-7-14-11/h4,6-7,9H,2-3,5H2,1H3,(H,16,17)(H,13,14,15) |
| InChIKey | NYQAKIFRKMBBJU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|